ChemNet > CAS > 368869-85-6 1-[4-(broommethyl)fenyl]-1H-pyrazol
368869-85-6 1-[4-(broommethyl)fenyl]-1H-pyrazol
Naam product |
1-[4-(broommethyl)fenyl]-1H-pyrazol |
Engelse naam |
1-[4-(bromomethyl)phenyl]-1H-pyrazole; |
MF |
C10H9BrN2 |
Molecuulgewicht |
237.0959 |
InChI |
InChI=1/C10H9BrN2/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8H2 |
CAS-nummer |
368869-85-6 |
Moleculaire Structuur |
|
Dichtheid |
1.44g/cm3 |
Smeltpunt |
77℃ |
Kookpunt |
315.3°C at 760 mmHg |
Brekingsindex |
1.623 |
Vlampunt |
144.5°C |
Dampdruk |
0.000816mmHg at 25°C |
Gevaarsymbolen |
C:Corrosive;
|
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|